C14H21BO4 — CID 157382639
2-(1,3-benzodioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane (PubChem CID 157382639) has the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane |
|---|---|
| PubChem CID | 157382639 |
| Molecular Formula | C14H21BO4 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methane |
| SMILES | C.CC1(C)OB(c2ccc3c(c2)OCO3)OC1(C)C |
| InChI | InChI=1S/C13H17BO4.CH4/c1-12(2)13(3,4)18-14(17-12)9-5-6-10-11(7-9)16-8-15-10;/h5-7H,8H2,1-4H3;1H4 |
| InChIKey | BLBHPHZJVNDFJY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|