C15H20BNO3S — CID 71118759
2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzothiazin-3-one (PubChem CID 71118759) has the molecular formula C15H20BNO3S and a molecular weight of 305.21 g/mol. Its IUPAC name is 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 71118759 |
| Molecular Formula | C15H20BNO3S |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4H-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2cc(B3OC(C)(C)C(C)(C)O3)ccc2NC1=O |
| InChI | InChI=1S/C15H20BNO3S/c1-9-13(18)17-11-7-6-10(8-12(11)21-9)16-19-14(2,3)15(4,5)20-16/h6-9H,1-5H3,(H,17,18) |
| InChIKey | HKGDSZGMELZYMI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|