C14H20BNO2S — CID 157073577
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 157073577) has the molecular formula C14H20BNO2S and a molecular weight of 277.20 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 157073577 |
| Molecular Formula | C14H20BNO2S |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CC1(C)OB(c2ccc3c(c2)SCC3N)OC1(C)C |
| InChI | InChI=1S/C14H20BNO2S/c1-13(2)14(3,4)18-15(17-13)9-5-6-10-11(16)8-19-12(10)7-9/h5-7,11H,8,16H2,1-4H3 |
| InChIKey | LQKXFYQNWLBHJR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|