C38H42B2O4 — CID 58142461
2-[9,10-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydroanthracen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 58142461) has the molecular formula C38H42B2O4 and a molecular weight of 584.37 g/mol. Its IUPAC name is 2-[9,10-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydroanthracen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,10-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydroanthracen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58142461 |
| Molecular Formula | C38H42B2O4 |
| Molecular Weight | 584.37 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2-[9,10-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydroanthracen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(c2ccccc2)c2ccc(B4OC(C)(C)C(C)(C)O4)cc2C3c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C38H42B2O4/c1-35(2)36(3,4)42-39(41-35)27-19-21-29-31(23-27)33(25-15-11-9-12-16-25)30-22-20-28(40-43-37(5,6)38(7,8)44-40)24-32(30)34(29)26-17-13-10-14-18-26/h9-24,33-34H,1-8H3 |
| InChIKey | FJVGLAJAQRQCNY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.37 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|