C23H29BN2O4 — CID 69217001
3-(1-hydroxy-2-methylpropan-2-yl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69217001) has the molecular formula C23H29BN2O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is 3-(1-hydroxy-2-methylpropan-2-yl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3-(1-hydroxy-2-methylpropan-2-yl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69217001 |
| Molecular Formula | C23H29BN2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-(1-hydroxy-2-methylpropan-2-yl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(C)(CO)c1ccc2c(c1)NC(=O)c1ccc(B3OC(C)(C)C(C)(C)O3)cc1N2 |
| InChI | InChI=1S/C23H29BN2O4/c1-21(2,13-27)14-7-10-17-19(11-14)26-20(28)16-9-8-15(12-18(16)25-17)24-29-22(3,4)23(5,6)30-24/h7-12,25,27H,13H2,1-6H3,(H,26,28) |
| InChIKey | ZIGIVBHZBBSYGS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|