C31H36BN3O5 — CID 59003065
3-[2-(4-morpholin-4-ylphenoxy)ethyl]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 59003065) has the molecular formula C31H36BN3O5 and a molecular weight of 541.46 g/mol. Its IUPAC name is 3-[2-(4-morpholin-4-ylphenoxy)ethyl]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3-[2-(4-morpholin-4-ylphenoxy)ethyl]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 59003065 |
| Molecular Formula | C31H36BN3O5 |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 3-[2-(4-morpholin-4-ylphenoxy)ethyl]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)Nc2ccc(CCOc4ccc(N5CCOCC5)cc4)cc2NC3=O)OC1(C)C |
| InChI | InChI=1S/C31H36BN3O5/c1-30(2)31(3,4)40-32(39-30)22-6-11-25-27(20-22)33-26-12-5-21(19-28(26)34-29(25)36)13-16-38-24-9-7-23(8-10-24)35-14-17-37-18-15-35/h5-12,19-20,33H,13-18H2,1-4H3,(H,34,36) |
| InChIKey | SYXYJMXNLWDQDD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|