C38H36N4O4 — CID 69217355
9-(4-anilino-3-methoxyphenyl)-3-[2-(4-morpholin-4-ylphenoxy)ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69217355) has the molecular formula C38H36N4O4 and a molecular weight of 612.73 g/mol. Its IUPAC name is 9-(4-anilino-3-methoxyphenyl)-3-[2-(4-morpholin-4-ylphenoxy)ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 9-(4-anilino-3-methoxyphenyl)-3-[2-(4-morpholin-4-ylphenoxy)ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69217355 |
| Molecular Formula | C38H36N4O4 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 9-(4-anilino-3-methoxyphenyl)-3-[2-(4-morpholin-4-ylphenoxy)ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(CCOc4ccc(N5CCOCC5)cc4)cc2NC3=O)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C38H36N4O4/c1-44-37-25-28(9-16-34(37)39-29-5-3-2-4-6-29)27-8-14-32-35(24-27)40-33-15-7-26(23-36(33)41-38(32)43)17-20-46-31-12-10-30(11-13-31)42-18-21-45-22-19-42/h2-16,23-25,39-40H,17-22H2,1H3,(H,41,43) |
| InChIKey | QGKNTMATXUZGPR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|