C23H27BN2O5 — CID 69218878
methyl 3-[6-oxo-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propanoate (PubChem CID 69218878) has the molecular formula C23H27BN2O5 and a molecular weight of 422.29 g/mol. Its IUPAC name is methyl 3-[6-oxo-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propanoate.
| Compound Name | methyl 3-[6-oxo-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propanoate |
|---|---|
| PubChem CID | 69218878 |
| Molecular Formula | C23H27BN2O5 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl 3-[6-oxo-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propanoate |
| SMILES | COC(=O)CCc1ccc2c(c1)NC(=O)c1ccc(B3OC(C)(C)C(C)(C)O3)cc1N2 |
| InChI | InChI=1S/C23H27BN2O5/c1-22(2)23(3,4)31-24(30-22)15-8-9-16-18(13-15)25-17-10-6-14(7-11-20(27)29-5)12-19(17)26-21(16)28/h6,8-10,12-13,25H,7,11H2,1-5H3,(H,26,28) |
| InChIKey | RVJSAJVTXUUEDV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|