C14H21BO5 — CID 166099273
methyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propanoate (PubChem CID 166099273) has the molecular formula C14H21BO5 and a molecular weight of 280.13 g/mol. Its IUPAC name is methyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propanoate.
| Compound Name | methyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propanoate |
|---|---|
| PubChem CID | 166099273 |
| Molecular Formula | C14H21BO5 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | methyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]propanoate |
| SMILES | COC(=O)CCc1ccc(B2OC(C)(C)C(C)(C)O2)o1 |
| InChI | InChI=1S/C14H21BO5/c1-13(2)14(3,4)20-15(19-13)11-8-6-10(18-11)7-9-12(16)17-5/h6,8H,7,9H2,1-5H3 |
| InChIKey | CSPNCTHPPFRRBW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|