About 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one
3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69217022) has the molecular formula C20H16ClN3O2
and a molecular weight of 365.82 g/mol. Its IUPAC name is 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
Molecular Properties
| Compound Name | 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| PubChem CID | 69217022 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(N)cc2NC3=O)ccc1Cl |
| InChI | InChI=1S/C20H16ClN3O2/c1-26-19-9-12(3-6-15(19)21)11-2-5-14-17(8-11)23-16-7-4-13(22)10-18(16)24-20(14)25/h2-10,23H,22H2,1H3,(H,24,25) |
| InChIKey | DNRLHRNFCRWIDM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The IUPAC name of 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CID 69217022) is 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
What is the SMILES notation for 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The canonical SMILES for 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one is COc1cc(-c2ccc3c(c2)Nc2ccc(N)cc2NC3=O)ccc1Cl.
What is the InChIKey of 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
The InChIKey is DNRLHRNFCRWIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3O2/c1-26-19-9-12(3-6-15(19)21)11-2-5-14-17(8-11)23-16-7-4-13(22)10-18(16)24-20(14)25/h2-10,23H,22H2,1H3,(H,24,25).
What are the key properties of 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one?
3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one has a molecular weight of 365.82 g/mol, XLogP of 4.91, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-9-(4-chloro-3-methoxyphenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one is sourced from PubChem (CID 69217022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).