C23H21N3O5 — CID 69219496
2-(3-hydroxypropyl)-9-(3-methoxy-4-nitrophenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69219496) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-9-(3-methoxy-4-nitrophenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 2-(3-hydroxypropyl)-9-(3-methoxy-4-nitrophenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69219496 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-(3-hydroxypropyl)-9-(3-methoxy-4-nitrophenyl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2cc(CCCO)ccc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21N3O5/c1-31-22-13-16(6-9-21(22)26(29)30)15-5-7-17-19(12-15)24-20-11-14(3-2-10-27)4-8-18(20)25-23(17)28/h4-9,11-13,24,27H,2-3,10H2,1H3,(H,25,28) |
| InChIKey | QZTWKKVQODKMAJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|