C28H21F3N4O5 — CID 69218757
9-(3-methoxy-4-nitrophenyl)-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69218757) has the molecular formula C28H21F3N4O5 and a molecular weight of 550.49 g/mol. Its IUPAC name is 9-(3-methoxy-4-nitrophenyl)-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 9-(3-methoxy-4-nitrophenyl)-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69218757 |
| Molecular Formula | C28H21F3N4O5 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 9-(3-methoxy-4-nitrophenyl)-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(CCn4cc(C(F)(F)F)ccc4=O)cc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H21F3N4O5/c1-40-25-14-18(4-8-24(25)35(38)39)17-3-6-20-22(13-17)32-21-7-2-16(12-23(21)33-27(20)37)10-11-34-15-19(28(29,30)31)5-9-26(34)36/h2-9,12-15,32H,10-11H2,1H3,(H,33,37) |
| InChIKey | UITKTIIVWNHOPC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|