C23H21ClN4O6S — CID 69226990
3-chloro-1-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propane-1-sulfonamide (PubChem CID 69226990) has the molecular formula C23H21ClN4O6S and a molecular weight of 516.96 g/mol. Its IUPAC name is 3-chloro-1-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propane-1-sulfonamide.
| Compound Name | 3-chloro-1-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 69226990 |
| Molecular Formula | C23H21ClN4O6S |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 3-chloro-1-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]propane-1-sulfonamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(C(CCCl)S(N)(=O)=O)cc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21ClN4O6S/c1-34-21-12-14(4-7-20(21)28(30)31)13-2-5-16-18(10-13)26-17-6-3-15(11-19(17)27-23(16)29)22(8-9-24)35(25,32)33/h2-7,10-12,22,26H,8-9H2,1H3,(H,27,29)(H2,25,32,33) |
| InChIKey | FYWKRSLJIZUCET-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|