C29H24N4O7S — CID 69216381
N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 69216381) has the molecular formula C29H24N4O7S and a molecular weight of 572.60 g/mol. Its IUPAC name is N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 69216381 |
| Molecular Formula | C29H24N4O7S |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(NC(=O)Cc4ccc(S(C)(=O)=O)cc4)cc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24N4O7S/c1-40-27-15-19(6-12-26(27)33(36)37)18-5-10-22-24(14-18)31-23-11-7-20(16-25(23)32-29(22)35)30-28(34)13-17-3-8-21(9-4-17)41(2,38)39/h3-12,14-16,31H,13H2,1-2H3,(H,30,34)(H,32,35) |
| InChIKey | CQSPIUGRCDMZST-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|