C25H18N4O5S — CID 69218732
N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]thiophene-3-carboxamide (PubChem CID 69218732) has the molecular formula C25H18N4O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]thiophene-3-carboxamide.
| Compound Name | N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 69218732 |
| Molecular Formula | C25H18N4O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]thiophene-3-carboxamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(NC(=O)c4ccsc4)cc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18N4O5S/c1-34-23-11-15(3-7-22(23)29(32)33)14-2-5-18-20(10-14)27-19-6-4-17(12-21(19)28-25(18)31)26-24(30)16-8-9-35-13-16/h2-13,27H,1H3,(H,26,30)(H,28,31) |
| InChIKey | UEAAFLZOOWCJEH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|