C31H23N5O5 — CID 69230501
2-[2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl]quinolin-6-yl]acetamide (PubChem CID 69230501) has the molecular formula C31H23N5O5 and a molecular weight of 545.56 g/mol. Its IUPAC name is 2-[2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl]quinolin-6-yl]acetamide.
| Compound Name | 2-[2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl]quinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 69230501 |
| Molecular Formula | C31H23N5O5 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-[2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-2-yl]quinolin-6-yl]acetamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2cc(-c4ccc5cc(CC(N)=O)ccc5n4)ccc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H23N5O5/c1-41-29-16-19(6-11-28(29)36(39)40)18-3-7-22-26(14-18)34-27-15-21(5-10-25(27)35-31(22)38)24-9-4-20-12-17(13-30(32)37)2-8-23(20)33-24/h2-12,14-16,34H,13H2,1H3,(H2,32,37)(H,35,38) |
| InChIKey | ATJKGHXEXOJDRN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|