C30H27N5O5 — CID 69227896
2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methyl-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 69227896) has the molecular formula C30H27N5O5 and a molecular weight of 537.58 g/mol. Its IUPAC name is 2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methyl-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methyl-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 69227896 |
| Molecular Formula | C30H27N5O5 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methyl-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(C(C)(C)C(=O)NCc4cccnc4)cc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H27N5O5/c1-30(2,29(37)32-17-18-5-4-12-31-16-18)21-8-10-23-25(15-21)34-28(36)22-9-6-19(13-24(22)33-23)20-7-11-26(35(38)39)27(14-20)40-3/h4-16,33H,17H2,1-3H3,(H,32,37)(H,34,36) |
| InChIKey | XTKLQOKLGUJDBP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|