C26H23N5O6 — CID 69219792
3-methoxy-9-(3-methoxy-4-nitrophenyl)-2-[(3-methylimidazol-4-yl)methoxy]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69219792) has the molecular formula C26H23N5O6 and a molecular weight of 501.50 g/mol. Its IUPAC name is 3-methoxy-9-(3-methoxy-4-nitrophenyl)-2-[(3-methylimidazol-4-yl)methoxy]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3-methoxy-9-(3-methoxy-4-nitrophenyl)-2-[(3-methylimidazol-4-yl)methoxy]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69219792 |
| Molecular Formula | C26H23N5O6 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 3-methoxy-9-(3-methoxy-4-nitrophenyl)-2-[(3-methylimidazol-4-yl)methoxy]-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc2c(cc1OCc1cncn1C)Nc1cc(-c3ccc([N+](=O)[O-])c(OC)c3)ccc1C(=O)N2 |
| InChI | InChI=1S/C26H23N5O6/c1-30-14-27-12-17(30)13-37-25-11-20-21(10-24(25)36-3)29-26(32)18-6-4-15(8-19(18)28-20)16-5-7-22(31(33)34)23(9-16)35-2/h4-12,14,28H,13H2,1-3H3,(H,29,32) |
| InChIKey | MVIMYNNYAYSTAH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|