C37H31FN4O6 — CID 118072093
N-[3-(3-fluorophenyl)-2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methylpropyl]-2-hydroxybenzamide (PubChem CID 118072093) has the molecular formula C37H31FN4O6 and a molecular weight of 646.68 g/mol. Its IUPAC name is N-[3-(3-fluorophenyl)-2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methylpropyl]-2-hydroxybenzamide.
| Compound Name | N-[3-(3-fluorophenyl)-2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methylpropyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 118072093 |
| Molecular Formula | C37H31FN4O6 |
| Molecular Weight | 646.68 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | N-[3-(3-fluorophenyl)-2-[9-(3-methoxy-4-nitrophenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]-2-methylpropyl]-2-hydroxybenzamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(C(C)(CNC(=O)c4ccccc4O)Cc4cccc(F)c4)cc2NC3=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C37H31FN4O6/c1-37(20-22-6-5-7-26(38)16-22,21-39-35(44)28-8-3-4-9-33(28)43)25-12-14-29-31(19-25)41-36(45)27-13-10-23(17-30(27)40-29)24-11-15-32(42(46)47)34(18-24)48-2/h3-19,40,43H,20-21H2,1-2H3,(H,39,44)(H,41,45) |
| InChIKey | AMFILGXLTMEFRQ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.68 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|