C24H21Cl2N3O3 — CID 69229619
4-chloro-N-[9-(4-chloro-3-methoxyphenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]butanamide (PubChem CID 69229619) has the molecular formula C24H21Cl2N3O3 and a molecular weight of 470.36 g/mol. Its IUPAC name is 4-chloro-N-[9-(4-chloro-3-methoxyphenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]butanamide.
| Compound Name | 4-chloro-N-[9-(4-chloro-3-methoxyphenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]butanamide |
|---|---|
| PubChem CID | 69229619 |
| Molecular Formula | C24H21Cl2N3O3 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 4-chloro-N-[9-(4-chloro-3-methoxyphenyl)-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-3-yl]butanamide |
| SMILES | COc1cc(-c2ccc3c(c2)Nc2ccc(NC(=O)CCCCl)cc2NC3=O)ccc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O3/c1-32-22-12-15(5-8-18(22)26)14-4-7-17-20(11-14)28-19-9-6-16(13-21(19)29-24(17)31)27-23(30)3-2-10-25/h4-9,11-13,28H,2-3,10H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | UJDPRTGCCGOIQH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|