C12H13Cl2NO3 — CID 55204060
methyl 2-chloro-5-(4-chlorobutanoylamino)benzoate (PubChem CID 55204060) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl 2-chloro-5-(4-chlorobutanoylamino)benzoate.
| Compound Name | methyl 2-chloro-5-(4-chlorobutanoylamino)benzoate |
|---|---|
| PubChem CID | 55204060 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | methyl 2-chloro-5-(4-chlorobutanoylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CCCCl)ccc1Cl |
| InChI | InChI=1S/C12H13Cl2NO3/c1-18-12(17)9-7-8(4-5-10(9)14)15-11(16)3-2-6-13/h4-5,7H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | ZYZAGBHLOHFCRQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|