C14H19ClN2O3 — CID 82011968
methyl 5-[(5-amino-4-methylpentanoyl)amino]-2-chlorobenzoate (PubChem CID 82011968) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is methyl 5-[(5-amino-4-methylpentanoyl)amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[(5-amino-4-methylpentanoyl)amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 82011968 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | methyl 5-[(5-amino-4-methylpentanoyl)amino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)CCC(C)CN)ccc1Cl |
| InChI | InChI=1S/C14H19ClN2O3/c1-9(8-16)3-6-13(18)17-10-4-5-12(15)11(7-10)14(19)20-2/h4-5,7,9H,3,6,8,16H2,1-2H3,(H,17,18) |
| InChIKey | AJLSFTZCSSQCEM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |