C24H33BO2 — CID 70914221
2-[4-(4-butan-2-ylphenyl)-3-ethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70914221) has the molecular formula C24H33BO2 and a molecular weight of 364.34 g/mol. Its IUPAC name is 2-[4-(4-butan-2-ylphenyl)-3-ethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(4-butan-2-ylphenyl)-3-ethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70914221 |
| Molecular Formula | C24H33BO2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 2-[4-(4-butan-2-ylphenyl)-3-ethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCc1cc(B2OC(C)(C)C(C)(C)O2)ccc1-c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C24H33BO2/c1-8-17(3)19-10-12-20(13-11-19)22-15-14-21(16-18(22)9-2)25-26-23(4,5)24(6,7)27-25/h10-17H,8-9H2,1-7H3 |
| InChIKey | KKWANLVXTKALGC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|