C27H41BN2O6 — CID 177241593
tert-butyl (2R,4R)-5-amino-2-tert-butyl-5-oxo-4-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]pentanoate (PubChem CID 177241593) has the molecular formula C27H41BN2O6 and a molecular weight of 500.45 g/mol. Its IUPAC name is tert-butyl (2R,4R)-5-amino-2-tert-butyl-5-oxo-4-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]pentanoate.
| Compound Name | tert-butyl (2R,4R)-5-amino-2-tert-butyl-5-oxo-4-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]pentanoate |
|---|---|
| PubChem CID | 177241593 |
| Molecular Formula | C27H41BN2O6 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | tert-butyl (2R,4R)-5-amino-2-tert-butyl-5-oxo-4-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]pentanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C[C@H](C(N)=O)N1Cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2C1=O)C(C)(C)C |
| InChI | InChI=1S/C27H41BN2O6/c1-24(2,3)19(23(33)34-25(4,5)6)14-20(21(29)31)30-15-16-13-17(11-12-18(16)22(30)32)28-35-26(7,8)27(9,10)36-28/h11-13,19-20H,14-15H2,1-10H3,(H2,29,31)/t19-,20+/m0/s1 |
| InChIKey | SXLFHYYGVWXESZ-VQTJNVASSA-N |
| XLogP | 3.19 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|