C30H44INO5Si — CID 86587739
tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2R)-6-iodo-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate (PubChem CID 86587739) has the molecular formula C30H44INO5Si and a molecular weight of 653.67 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2R)-6-iodo-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2R)-6-iodo-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 86587739 |
| Molecular Formula | C30H44INO5Si |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | tert-butyl N-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2R)-6-iodo-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@H]1CCc2cc(I)ccc2O1)C[C@@H](COc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H44INO5Si/c1-29(2,3)36-28(33)32(19-25-16-14-22-18-23(31)15-17-27(22)35-25)20-26(37-38(7,8)30(4,5)6)21-34-24-12-10-9-11-13-24/h9-13,15,17-18,25-26H,14,16,19-21H2,1-8H3/t25-,26+/m1/s1 |
| InChIKey | JLXPXRYJSBNLTD-FTJBHMTQSA-N |
| XLogP | 7.69 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|