C20H33NO4Si — CID 18363085
(E)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)propoxy]phenyl]prop-2-enoic acid (PubChem CID 18363085) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is (E)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)propoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)propoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18363085 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | (E)-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)propoxy]phenyl]prop-2-enoic acid |
| SMILES | CN(C)CC(COc1ccc(/C=C/C(=O)O)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO4Si/c1-20(2,3)26(6,7)25-18(14-21(4)5)15-24-17-11-8-16(9-12-17)10-13-19(22)23/h8-13,18H,14-15H2,1-7H3,(H,22,23)/b13-10+ |
| InChIKey | IZIJBKZNJASSBO-JLHYYAGUSA-N |
| XLogP | 4.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|