C32H50O5Si2 — CID 150685217
(E)-3-[4-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]butoxy]phenyl]phenyl]prop-2-enoic acid (PubChem CID 150685217) has the molecular formula C32H50O5Si2 and a molecular weight of 570.92 g/mol. Its IUPAC name is (E)-3-[4-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]butoxy]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]butoxy]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 150685217 |
| Molecular Formula | C32H50O5Si2 |
| Molecular Weight | 570.92 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | (E)-3-[4-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]butoxy]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CCOc1ccc(-c2ccc(/C=C/C(=O)O)cc2)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H50O5Si2/c1-31(2,3)38(7,8)36-23-26(24-37-39(9,10)32(4,5)6)21-22-35-29-18-16-28(17-19-29)27-14-11-25(12-15-27)13-20-30(33)34/h11-20,26H,21-24H2,1-10H3,(H,33,34)/b20-13+ |
| InChIKey | JISFKEJHWXPCIA-DEDYPNTBSA-N |
| XLogP | 8.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.92 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|