C18H32O6SSi — CID 90743223
(2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methoxyphenoxy)butane-1-sulfonic acid (PubChem CID 90743223) has the molecular formula C18H32O6SSi and a molecular weight of 404.60 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methoxyphenoxy)butane-1-sulfonic acid.
| Compound Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methoxyphenoxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 90743223 |
| Molecular Formula | C18H32O6SSi |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-methoxyphenoxy)butane-1-sulfonic acid |
| SMILES | COc1ccc(OCCC(CO[Si](C)(C)C(C)(C)C)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H32O6SSi/c1-18(2,3)26(5,6)24-13-15(14-25(19,20)21)11-12-23-17-9-7-16(22-4)8-10-17/h7-10,15H,11-14H2,1-6H3,(H,19,20,21) |
| InChIKey | SQDILIBDYOYDNU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|