C53H96O7Si4 — CID 151765433
(E)-1,3-bis[4-[3,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pentoxy]phenyl]prop-2-en-1-one (PubChem CID 151765433) has the molecular formula C53H96O7Si4 and a molecular weight of 957.69 g/mol. Its IUPAC name is (E)-1,3-bis[4-[3,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pentoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1,3-bis[4-[3,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pentoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 151765433 |
| Molecular Formula | C53H96O7Si4 |
| Molecular Weight | 957.69 g/mol |
| Exact Mass | 956.62 |
| IUPAC Name | (E)-1,3-bis[4-[3,3-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pentoxy]phenyl]prop-2-en-1-one |
| SMILES | CCC(CCOc1ccc(/C=C/C(=O)c2ccc(OCCC(CC)(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)cc2)cc1)(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C53H96O7Si4/c1-23-52(39-57-61(15,16)48(3,4)5,40-58-62(17,18)49(6,7)8)35-37-55-45-30-25-43(26-31-45)27-34-47(54)44-28-32-46(33-29-44)56-38-36-53(24-2,41-59-63(19,20)50(9,10)11)42-60-64(21,22)51(12,13)14/h25-34H,23-24,35-42H2,1-22H3/b34-27+ |
| InChIKey | RRLWHHSOOGNINI-DNGXXSEMSA-N |
| XLogP | 16.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.69 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|