C25H44BNO6Si — CID 140702072
propan-2-yl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propan-2-yl]carbamate (PubChem CID 140702072) has the molecular formula C25H44BNO6Si and a molecular weight of 493.53 g/mol. Its IUPAC name is propan-2-yl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 140702072 |
| Molecular Formula | C25H44BNO6Si |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | propan-2-yl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propan-2-yl]carbamate |
| SMILES | CC(C)OC(=O)N[C@H](COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44BNO6Si/c1-18(2)31-22(28)27-20(17-30-34(10,11)23(3,4)5)16-29-21-14-12-19(13-15-21)26-32-24(6,7)25(8,9)33-26/h12-15,18,20H,16-17H2,1-11H3,(H,27,28)/t20-/m1/s1 |
| InChIKey | COVBOQXIPSLMNG-HXUWFJFHSA-N |
| XLogP | 4.89 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|