C14H25NO4Si — CID 66820233
tert-butyl-dimethyl-[[4-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane (PubChem CID 66820233) has the molecular formula C14H25NO4Si and a molecular weight of 299.44 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[4-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[4-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 66820233 |
| Molecular Formula | C14H25NO4Si |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl-dimethyl-[[4-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]methoxy]silane |
| SMILES | CC1(c2coc(CO[Si](C)(C)C(C)(C)C)n2)OCCO1 |
| InChI | InChI=1S/C14H25NO4Si/c1-13(2,3)20(5,6)19-10-12-15-11(9-16-12)14(4)17-7-8-18-14/h9H,7-8,10H2,1-6H3 |
| InChIKey | ZJLIWZMKOIOGLT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|