C15H24F2N2O2Si — CID 154620683
1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-3,3-difluorocyclobutan-1-ol (PubChem CID 154620683) has the molecular formula C15H24F2N2O2Si and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-3,3-difluorocyclobutan-1-ol.
| Compound Name | 1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-3,3-difluorocyclobutan-1-ol |
|---|---|
| PubChem CID | 154620683 |
| Molecular Formula | C15H24F2N2O2Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-3,3-difluorocyclobutan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccnc(C2(O)CC(F)(F)C2)n1 |
| InChI | InChI=1S/C15H24F2N2O2Si/c1-13(2,3)22(4,5)21-8-11-6-7-18-12(19-11)14(20)9-15(16,17)10-14/h6-7,20H,8-10H2,1-5H3 |
| InChIKey | MHKUYVUTEUFWHO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|