C19H32N2O2Si — CID 154608214
[(1R)-4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-1-methylcyclohex-3-en-1-yl]methanol (PubChem CID 154608214) has the molecular formula C19H32N2O2Si and a molecular weight of 348.56 g/mol. Its IUPAC name is [(1R)-4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-1-methylcyclohex-3-en-1-yl]methanol.
| Compound Name | [(1R)-4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-1-methylcyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 154608214 |
| Molecular Formula | C19H32N2O2Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [(1R)-4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-1-methylcyclohex-3-en-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccnc(C2=CC[C@](C)(CO)CC2)n1 |
| InChI | InChI=1S/C19H32N2O2Si/c1-18(2,3)24(5,6)23-13-16-9-12-20-17(21-16)15-7-10-19(4,14-22)11-8-15/h7,9,12,22H,8,10-11,13-14H2,1-6H3/t19-/m0/s1 |
| InChIKey | XVBSLKUKVRLPSH-IBGZPJMESA-N |
| XLogP | 4.56 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|