C22H40FN3O5Si — CID 151882012
3-[2-[[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-4-fluoropiperidin-4-yl]methoxy]ethoxy]propane-1,2-diol (PubChem CID 151882012) has the molecular formula C22H40FN3O5Si and a molecular weight of 473.66 g/mol. Its IUPAC name is 3-[2-[[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-4-fluoropiperidin-4-yl]methoxy]ethoxy]propane-1,2-diol.
| Compound Name | 3-[2-[[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-4-fluoropiperidin-4-yl]methoxy]ethoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 151882012 |
| Molecular Formula | C22H40FN3O5Si |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 3-[2-[[1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrimidin-2-yl]-4-fluoropiperidin-4-yl]methoxy]ethoxy]propane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccnc(N2CCC(F)(COCCOCC(O)CO)CC2)n1 |
| InChI | InChI=1S/C22H40FN3O5Si/c1-21(2,3)32(4,5)31-15-18-6-9-24-20(25-18)26-10-7-22(23,8-11-26)17-30-13-12-29-16-19(28)14-27/h6,9,19,27-28H,7-8,10-17H2,1-5H3 |
| InChIKey | SOXQDYLZTWBTCA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|