C23H45NO5Si2 — CID 11102770
(3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazol-2-yl]-3-methoxyhexanal (PubChem CID 11102770) has the molecular formula C23H45NO5Si2 and a molecular weight of 471.79 g/mol. Its IUPAC name is (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazol-2-yl]-3-methoxyhexanal.
| Compound Name | (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazol-2-yl]-3-methoxyhexanal |
|---|---|
| PubChem CID | 11102770 |
| Molecular Formula | C23H45NO5Si2 |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazol-2-yl]-3-methoxyhexanal |
| SMILES | CO[C@H](CC=O)C[C@@H](Cc1nc(CO[Si](C)(C)C(C)(C)C)co1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45NO5Si2/c1-22(2,3)30(8,9)28-17-18-16-27-21(24-18)15-20(14-19(26-7)12-13-25)29-31(10,11)23(4,5)6/h13,16,19-20H,12,14-15,17H2,1-11H3/t19-,20+/m1/s1 |
| InChIKey | XWZYQUZPLDIVRO-UXHICEINSA-N |
| XLogP | 6.12 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|