C25H39NO5Si — CID 71490748
2-[(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methylhexyl]-1,3-oxazole-4-carbaldehyde (PubChem CID 71490748) has the molecular formula C25H39NO5Si and a molecular weight of 461.68 g/mol. Its IUPAC name is 2-[(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methylhexyl]-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-[(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methylhexyl]-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 71490748 |
| Molecular Formula | C25H39NO5Si |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 2-[(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methylhexyl]-1,3-oxazole-4-carbaldehyde |
| SMILES | CC[C@@H](OCc1ccc(OC)cc1)[C@@H](C)[C@H](Cc1nc(C=O)co1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39NO5Si/c1-9-22(29-16-19-10-12-21(28-6)13-11-19)18(2)23(31-32(7,8)25(3,4)5)14-24-26-20(15-27)17-30-24/h10-13,15,17-18,22-23H,9,14,16H2,1-8H3/t18-,22-,23+/m1/s1 |
| InChIKey | GHNLXOHVEVLDMZ-YSZBQJHXSA-N |
| XLogP | 6.06 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|