About 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol
2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol (PubChem CID 10493896) has the molecular formula C17H28O2Si
and a molecular weight of 292.50 g/mol. Its IUPAC name is 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol |
| PubChem CID | 10493896 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(/C=C\CO[Si](C)(C)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C17H28O2Si/c1-13-11-14(2)15(16(18)12-13)9-8-10-19-20(6,7)17(3,4)5/h8-9,11-12,18H,10H2,1-7H3/b9-8- |
| InChIKey | TVGDYSPVIFXYNB-HJWRWDBZSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol?
The IUPAC name of 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol (CID 10493896) is 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol.
What is the SMILES notation for 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol?
The canonical SMILES for 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol is Cc1cc(C)c(/C=C\CO[Si](C)(C)C(C)(C)C)c(O)c1.
What is the InChIKey of 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol?
The InChIKey is TVGDYSPVIFXYNB-HJWRWDBZSA-N. The full InChI is InChI=1S/C17H28O2Si/c1-13-11-14(2)15(16(18)12-13)9-8-10-19-20(6,7)17(3,4)5/h8-9,11-12,18H,10H2,1-7H3/b9-8-.
What are the key properties of 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol?
2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol has a molecular weight of 292.50 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-3,5-dimethylphenol is sourced from PubChem (CID 10493896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).