C8H4BrClO3 — CID 23643774
5-bromo-1,3-benzodioxole-4-carbonyl chloride (PubChem CID 23643774) has the molecular formula C8H4BrClO3 and a molecular weight of 263.47 g/mol. Its IUPAC name is 5-bromo-1,3-benzodioxole-4-carbonyl chloride.
| Compound Name | 5-bromo-1,3-benzodioxole-4-carbonyl chloride |
|---|---|
| PubChem CID | 23643774 |
| Molecular Formula | C8H4BrClO3 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | 5-bromo-1,3-benzodioxole-4-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C8H4BrClO3/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2 |
| InChIKey | OABXMWUOPHWNHH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|