About 5-bromo-1,3-benzodioxole-4-carbonyl chloride
5-bromo-1,3-benzodioxole-4-carbonyl chloride (PubChem CID 23643774) has the molecular formula C8H4BrClO3
and a molecular weight of 263.47 g/mol. Its IUPAC name is 5-bromo-1,3-benzodioxole-4-carbonyl chloride.
Molecular Properties
| Compound Name | 5-bromo-1,3-benzodioxole-4-carbonyl chloride |
| PubChem CID | 23643774 |
| Molecular Formula | C8H4BrClO3 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | 5-bromo-1,3-benzodioxole-4-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C8H4BrClO3/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2 |
| InChIKey | OABXMWUOPHWNHH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1,3-benzodioxole-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-benzodioxole-4-carbonyl chloride?
The IUPAC name of 5-bromo-1,3-benzodioxole-4-carbonyl chloride (CID 23643774) is 5-bromo-1,3-benzodioxole-4-carbonyl chloride.
What is the SMILES notation for 5-bromo-1,3-benzodioxole-4-carbonyl chloride?
The canonical SMILES for 5-bromo-1,3-benzodioxole-4-carbonyl chloride is O=C(Cl)c1c(Br)ccc2c1OCO2.
What is the InChIKey of 5-bromo-1,3-benzodioxole-4-carbonyl chloride?
The InChIKey is OABXMWUOPHWNHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrClO3/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2.
What are the key properties of 5-bromo-1,3-benzodioxole-4-carbonyl chloride?
5-bromo-1,3-benzodioxole-4-carbonyl chloride has a molecular weight of 263.47 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-benzodioxole-4-carbonyl chloride is sourced from PubChem (CID 23643774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).