C15H11NO4 — CID 90821592
5-[2-(nitrosomethyl)phenyl]-1,3-benzodioxole-4-carbaldehyde (PubChem CID 90821592) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 5-[2-(nitrosomethyl)phenyl]-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-[2-(nitrosomethyl)phenyl]-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 90821592 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-[2-(nitrosomethyl)phenyl]-1,3-benzodioxole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2ccccc2CN=O)ccc2c1OCO2 |
| InChI | InChI=1S/C15H11NO4/c17-8-13-12(5-6-14-15(13)20-9-19-14)11-4-2-1-3-10(11)7-16-18/h1-6,8H,7,9H2 |
| InChIKey | LWJYZEIJEXZFIW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|