C20H15NO5 — CID 162952044
5-[5-(methylamino)benzo[f][1,3]benzodioxol-6-yl]-1,3-benzodioxole-4-carbaldehyde (PubChem CID 162952044) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-[5-(methylamino)benzo[f][1,3]benzodioxol-6-yl]-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-[5-(methylamino)benzo[f][1,3]benzodioxol-6-yl]-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 162952044 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-[5-(methylamino)benzo[f][1,3]benzodioxol-6-yl]-1,3-benzodioxole-4-carbaldehyde |
| SMILES | CNc1c(-c2ccc3c(c2C=O)OCO3)ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C20H15NO5/c1-21-19-13(12-4-5-16-20(15(12)8-22)26-10-23-16)3-2-11-6-17-18(7-14(11)19)25-9-24-17/h2-8,21H,9-10H2,1H3 |
| InChIKey | UUOCDFGUEXAVIL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|