C13H18BrN2O3+ — CID 4261852
[2-[(5-bromo-1,3-benzodioxol-4-yl)amino]-2-oxoethyl]-diethylazanium (PubChem CID 4261852) has the molecular formula C13H18BrN2O3+ and a molecular weight of 330.20 g/mol. Its IUPAC name is [2-[(5-bromo-1,3-benzodioxol-4-yl)amino]-2-oxoethyl]-diethylazanium.
| Compound Name | [2-[(5-bromo-1,3-benzodioxol-4-yl)amino]-2-oxoethyl]-diethylazanium |
|---|---|
| PubChem CID | 4261852 |
| Molecular Formula | C13H18BrN2O3+ |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [2-[(5-bromo-1,3-benzodioxol-4-yl)amino]-2-oxoethyl]-diethylazanium |
| SMILES | CC[NH+](CC)CC(=O)Nc1c(Br)ccc2c1OCO2 |
| InChI | InChI=1S/C13H17BrN2O3/c1-3-16(4-2)7-11(17)15-12-9(14)5-6-10-13(12)19-8-18-10/h5-6H,3-4,7-8H2,1-2H3,(H,15,17)/p+1 |
| InChIKey | HAJUIGOEXWFTAW-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |