C9H6BrClO3 — CID 131851730
2-(4-bromo-1,3-benzodioxol-5-yl)acetyl chloride (PubChem CID 131851730) has the molecular formula C9H6BrClO3 and a molecular weight of 277.50 g/mol. Its IUPAC name is 2-(4-bromo-1,3-benzodioxol-5-yl)acetyl chloride.
| Compound Name | 2-(4-bromo-1,3-benzodioxol-5-yl)acetyl chloride |
|---|---|
| PubChem CID | 131851730 |
| Molecular Formula | C9H6BrClO3 |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 275.92 |
| IUPAC Name | 2-(4-bromo-1,3-benzodioxol-5-yl)acetyl chloride |
| SMILES | O=C(Cl)Cc1ccc2c(c1Br)OCO2 |
| InChI | InChI=1S/C9H6BrClO3/c10-8-5(3-7(11)12)1-2-6-9(8)14-4-13-6/h1-2H,3-4H2 |
| InChIKey | YTCSRYQARJZSSV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|