C10H10O4 — CID 117284324
5-(1-hydroxycyclopropyl)-1,3-benzodioxol-4-ol (PubChem CID 117284324) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 5-(1-hydroxycyclopropyl)-1,3-benzodioxol-4-ol.
| Compound Name | 5-(1-hydroxycyclopropyl)-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 117284324 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 5-(1-hydroxycyclopropyl)-1,3-benzodioxol-4-ol |
| SMILES | Oc1c(C2(O)CC2)ccc2c1OCO2 |
| InChI | InChI=1S/C10H10O4/c11-8-6(10(12)3-4-10)1-2-7-9(8)14-5-13-7/h1-2,11-12H,3-5H2 |
| InChIKey | VMLZEQGXOUAKPC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |