C10H9ClO3 — CID 117303319
1-(6-chloro-1,3-benzodioxol-4-yl)cyclopropan-1-ol (PubChem CID 117303319) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzodioxol-4-yl)cyclopropan-1-ol.
| Compound Name | 1-(6-chloro-1,3-benzodioxol-4-yl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 117303319 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1-(6-chloro-1,3-benzodioxol-4-yl)cyclopropan-1-ol |
| SMILES | OC1(c2cc(Cl)cc3c2OCO3)CC1 |
| InChI | InChI=1S/C10H9ClO3/c11-6-3-7(10(12)1-2-10)9-8(4-6)13-5-14-9/h3-4,12H,1-2,5H2 |
| InChIKey | HAISFCDGXAOXQA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |