C12H14ClNO2 — CID 117351983
2-(6-chloro-1,3-benzodioxol-4-yl)-2-methylpyrrolidine (PubChem CID 117351983) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzodioxol-4-yl)-2-methylpyrrolidine.
| Compound Name | 2-(6-chloro-1,3-benzodioxol-4-yl)-2-methylpyrrolidine |
|---|---|
| PubChem CID | 117351983 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-(6-chloro-1,3-benzodioxol-4-yl)-2-methylpyrrolidine |
| SMILES | CC1(c2cc(Cl)cc3c2OCO3)CCCN1 |
| InChI | InChI=1S/C12H14ClNO2/c1-12(3-2-4-14-12)9-5-8(13)6-10-11(9)16-7-15-10/h5-6,14H,2-4,7H2,1H3 |
| InChIKey | WKXWNHKREDYZGR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |