About 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine
2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine (PubChem CID 117423013) has the molecular formula C14H18ClNO2
and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine |
| PubChem CID | 117423013 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine |
| SMILES | CC1(C)Oc2cc(Cl)c(C3(C)CCCN3)cc2O1 |
| InChI | InChI=1S/C14H18ClNO2/c1-13(2)17-11-7-9(10(15)8-12(11)18-13)14(3)5-4-6-16-14/h7-8,16H,4-6H2,1-3H3 |
| InChIKey | ZAAPHOKPQYRNOS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine?
The IUPAC name of 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine (CID 117423013) is 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine.
What is the SMILES notation for 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine?
The canonical SMILES for 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine is CC1(C)Oc2cc(Cl)c(C3(C)CCCN3)cc2O1.
What is the InChIKey of 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine?
The InChIKey is ZAAPHOKPQYRNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO2/c1-13(2)17-11-7-9(10(15)8-12(11)18-13)14(3)5-4-6-16-14/h7-8,16H,4-6H2,1-3H3.
What are the key properties of 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine?
2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine has a molecular weight of 267.76 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-2,2-dimethyl-1,3-benzodioxol-5-yl)-2-methylpyrrolidine is sourced from PubChem (CID 117423013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).