C11H9ClO4 — CID 117353871
5-chloro-7-(1-hydroxycyclopropyl)-1,3-benzodioxole-4-carbaldehyde (PubChem CID 117353871) has the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. Its IUPAC name is 5-chloro-7-(1-hydroxycyclopropyl)-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-chloro-7-(1-hydroxycyclopropyl)-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 117353871 |
| Molecular Formula | C11H9ClO4 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 5-chloro-7-(1-hydroxycyclopropyl)-1,3-benzodioxole-4-carbaldehyde |
| SMILES | O=Cc1c(Cl)cc(C2(O)CC2)c2c1OCO2 |
| InChI | InChI=1S/C11H9ClO4/c12-8-3-7(11(14)1-2-11)10-9(6(8)4-13)15-5-16-10/h3-4,14H,1-2,5H2 |
| InChIKey | LEQLJNHGNGFENB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|