C14H13ClO5 — CID 117477904
2-[1-(6-chloro-5-formyl-2,3-dihydro-1,4-benzodioxin-8-yl)cyclopropyl]acetic acid (PubChem CID 117477904) has the molecular formula C14H13ClO5 and a molecular weight of 296.71 g/mol. Its IUPAC name is 2-[1-(6-chloro-5-formyl-2,3-dihydro-1,4-benzodioxin-8-yl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(6-chloro-5-formyl-2,3-dihydro-1,4-benzodioxin-8-yl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117477904 |
| Molecular Formula | C14H13ClO5 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-[1-(6-chloro-5-formyl-2,3-dihydro-1,4-benzodioxin-8-yl)cyclopropyl]acetic acid |
| SMILES | O=Cc1c(Cl)cc(C2(CC(=O)O)CC2)c2c1OCCO2 |
| InChI | InChI=1S/C14H13ClO5/c15-10-5-9(14(1-2-14)6-11(17)18)13-12(8(10)7-16)19-3-4-20-13/h5,7H,1-4,6H2,(H,17,18) |
| InChIKey | FPJMNHCYIWYPGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|