2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid

C13H13ClO4 — CID 117425149

IUPAC2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2cc(Cl)cc3c2OCOC3)CC1
InChIInChI=1S/C13H13ClO4/c14-9-3-8-6-17-7-18-12(8)10(4-9)13(1-2-13)5-11(15)16/h3-4H,1-2,5-7H2,(H,15,16)
InChIKeyZQVTYWZUWGAHMT-UHFFFAOYSA-N
MW268.70 g/mol
LogP2.71
Rot. Bonds3

About 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid

2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid (PubChem CID 117425149) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid
PubChem CID117425149
Molecular FormulaC13H13ClO4
Molecular Weight268.70 g/mol
Exact Mass268.05
IUPAC Name2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid
SMILESO=C(O)CC1(c2cc(Cl)cc3c2OCOC3)CC1
InChIInChI=1S/C13H13ClO4/c14-9-3-8-6-17-7-18-12(8)10(4-9)13(1-2-13)5-11(15)16/h3-4H,1-2,5-7H2,(H,15,16)
InChIKeyZQVTYWZUWGAHMT-UHFFFAOYSA-N
XLogP2.71
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.70
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid (CID 117425149) is 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid is O=C(O)CC1(c2cc(Cl)cc3c2OCOC3)CC1.
What is the InChIKey of 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid?
The InChIKey is ZQVTYWZUWGAHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO4/c14-9-3-8-6-17-7-18-12(8)10(4-9)13(1-2-13)5-11(15)16/h3-4H,1-2,5-7H2,(H,15,16).
What are the key properties of 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid?
2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid has a molecular weight of 268.70 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(6-chloro-4H-1,3-benzodioxin-8-yl)cyclopropyl]acetic acid is sourced from PubChem (CID 117425149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).