About 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol
4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol (PubChem CID 58219553) has the molecular formula C14H10O6
and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol |
| PubChem CID | 58219553 |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol |
| SMILES | Oc1ccc2c(c1-c1c(O)ccc3c1OCO3)OCO2 |
| InChI | InChI=1S/C14H10O6/c15-7-1-3-9-13(19-5-17-9)11(7)12-8(16)2-4-10-14(12)20-6-18-10/h1-4,15-16H,5-6H2 |
| InChIKey | FEIJYRFLOJAPNF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol?
The IUPAC name of 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol (CID 58219553) is 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol.
What is the SMILES notation for 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol?
The canonical SMILES for 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol is Oc1ccc2c(c1-c1c(O)ccc3c1OCO3)OCO2.
What is the InChIKey of 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol?
The InChIKey is FEIJYRFLOJAPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O6/c15-7-1-3-9-13(19-5-17-9)11(7)12-8(16)2-4-10-14(12)20-6-18-10/h1-4,15-16H,5-6H2.
What are the key properties of 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol?
4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol has a molecular weight of 274.23 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-hydroxy-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-ol is sourced from PubChem (CID 58219553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).